C17H14MnN3O2S — CID 139074438
manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;isothiocyanate (PubChem CID 139074438) has the molecular formula C17H14MnN3O2S and a molecular weight of 379.32 g/mol. Its IUPAC name is manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;isothiocyanate.
| Compound Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;isothiocyanate |
|---|---|
| PubChem CID | 139074438 |
| Molecular Formula | C17H14MnN3O2S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;isothiocyanate |
| SMILES | [Mn+3].[N-]=C=S.[O-]c1ccccc1/C=N/CC/N=C/c1ccccc1[O-] |
| InChI | InChI=1S/C16H16N2O2.CNS.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;2-1-3;/h1-8,11-12,19-20H,9-10H2;;/q;-1;+3/p-2/b17-11+,18-12+;; |
| InChIKey | FLIMBRLTJDWXKS-SNTCFBDDSA-L |
| XLogP | 2.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|