C18H18CuN2O2 — CID 139055616
copper 2-[4-[(2-oxidophenyl)methylideneamino]butyliminomethyl]phenolate (PubChem CID 139055616) has the molecular formula C18H18CuN2O2 and a molecular weight of 357.90 g/mol. Its IUPAC name is copper 2-[4-[(2-oxidophenyl)methylideneamino]butyliminomethyl]phenolate.
| Compound Name | copper 2-[4-[(2-oxidophenyl)methylideneamino]butyliminomethyl]phenolate |
|---|---|
| PubChem CID | 139055616 |
| Molecular Formula | C18H18CuN2O2 |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | copper 2-[4-[(2-oxidophenyl)methylideneamino]butyliminomethyl]phenolate |
| SMILES | [Cu+2].[O-]c1ccccc1/C=N/CCCC/N=C/c1ccccc1[O-] |
| InChI | InChI=1S/C18H20N2O2.Cu/c21-17-9-3-1-7-15(17)13-19-11-5-6-12-20-14-16-8-2-4-10-18(16)22;/h1-4,7-10,13-14,21-22H,5-6,11-12H2;/q;+2/p-2/b19-13+,20-14+; |
| InChIKey | OJMWCBFIRUCRAK-WKLZLTIDSA-L |
| XLogP | 2.15 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|