C16H14MnN2O2+ — CID 6711806
manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate (PubChem CID 6711806) has the molecular formula C16H14MnN2O2+ and a molecular weight of 321.24 g/mol. Its IUPAC name is manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate.
| Compound Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate |
|---|---|
| PubChem CID | 6711806 |
| Molecular Formula | C16H14MnN2O2+ |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate |
| SMILES | [Mn+3].[O-]c1ccccc1/C=N/CC/N=C/c1ccccc1[O-] |
| InChI | InChI=1S/C16H16N2O2.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+3/p-2/b17-11+,18-12+; |
| InChIKey | ZTVLCLVMEVOQRI-OYJDLGDISA-L |
| XLogP | 1.37 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|