C18H20N2S2 — CID 136866170
2-[4-[(2-sulfanylphenyl)methylideneamino]butyliminomethyl]benzenethiol (PubChem CID 136866170) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 2-[4-[(2-sulfanylphenyl)methylideneamino]butyliminomethyl]benzenethiol.
| Compound Name | 2-[4-[(2-sulfanylphenyl)methylideneamino]butyliminomethyl]benzenethiol |
|---|---|
| PubChem CID | 136866170 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[4-[(2-sulfanylphenyl)methylideneamino]butyliminomethyl]benzenethiol |
| SMILES | Sc1ccccc1/C=N/CCCC/N=C/c1ccccc1S |
| InChI | InChI=1S/C18H20N2S2/c21-17-9-3-1-7-15(17)13-19-11-5-6-12-20-14-16-8-2-4-10-18(16)22/h1-4,7-10,13-14,21-22H,5-6,11-12H2/b19-13+,20-14+ |
| InChIKey | RLFNCAVLXGPPRU-IWGRKNQJSA-N |
| XLogP | 4.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|