C19H22N2S2 — CID 136729251
2-[[2,2-dimethyl-3-[(2-sulfanylphenyl)methylideneamino]propyl]iminomethyl]benzenethiol (PubChem CID 136729251) has the molecular formula C19H22N2S2 and a molecular weight of 342.53 g/mol. Its IUPAC name is 2-[[2,2-dimethyl-3-[(2-sulfanylphenyl)methylideneamino]propyl]iminomethyl]benzenethiol.
| Compound Name | 2-[[2,2-dimethyl-3-[(2-sulfanylphenyl)methylideneamino]propyl]iminomethyl]benzenethiol |
|---|---|
| PubChem CID | 136729251 |
| Molecular Formula | C19H22N2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[[2,2-dimethyl-3-[(2-sulfanylphenyl)methylideneamino]propyl]iminomethyl]benzenethiol |
| SMILES | CC(C)(C/N=C/c1ccccc1S)C/N=C/c1ccccc1S |
| InChI | InChI=1S/C19H22N2S2/c1-19(2,13-20-11-15-7-3-5-9-17(15)22)14-21-12-16-8-4-6-10-18(16)23/h3-12,22-23H,13-14H2,1-2H3/b20-11+,21-12+ |
| InChIKey | JWUHQBJFPNBSNA-HGEIODPWSA-N |
| XLogP | 4.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|