C16H18CoN2O3 — CID 135442959
cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate (PubChem CID 135442959) has the molecular formula C16H18CoN2O3 and a molecular weight of 345.26 g/mol. Its IUPAC name is cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate.
| Compound Name | cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate |
|---|---|
| PubChem CID | 135442959 |
| Molecular Formula | C16H18CoN2O3 |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;hydrate |
| SMILES | O.Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Co] |
| InChI | InChI=1S/C16H16N2O2.Co.H2O/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;;1H2/b17-11+,18-12+;; |
| InChIKey | KMPNPNYOEISGRQ-SNTCFBDDSA-N |
| XLogP | 1.81 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|