C16H16ClCrN2O7- — CID 135406501
2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;oxochromium;perchlorate (PubChem CID 135406501) has the molecular formula C16H16ClCrN2O7- and a molecular weight of 435.76 g/mol. Its IUPAC name is 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;oxochromium;perchlorate.
| Compound Name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;oxochromium;perchlorate |
|---|---|
| PubChem CID | 135406501 |
| Molecular Formula | C16H16ClCrN2O7- |
| Molecular Weight | 435.76 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol;oxochromium;perchlorate |
| SMILES | O=[Cr].Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16N2O2.ClHO4.Cr.O/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;2-1(3,4)5;;/h1-8,11-12,19-20H,9-10H2;(H,2,3,4,5);;/p-1/b17-11+,18-12+;;; |
| InChIKey | XYTTUYWVDFEYQS-MCRPVJKSSA-M |
| XLogP | -2.24 |
| TPSA | 174.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.76 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|