C16H16CoN2NaO2+ — CID 135544422
sodium;cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol (PubChem CID 135544422) has the molecular formula C16H16CoN2NaO2+ and a molecular weight of 350.24 g/mol. Its IUPAC name is sodium;cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol.
| Compound Name | sodium;cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 135544422 |
| Molecular Formula | C16H16CoN2NaO2+ |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | sodium;cobalt;2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/CC/N=C/c1ccccc1O.[Co].[Na+] |
| InChI | InChI=1S/C16H16N2O2.Co.Na/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;;/q;;+1/b17-11+,18-12+;; |
| InChIKey | MXHOVNWZFSSXIR-SNTCFBDDSA-N |
| XLogP | -0.36 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|