C18H20CuN3O2 — CID 135987878
bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]azanide;copper(1+) (PubChem CID 135987878) has the molecular formula C18H20CuN3O2 and a molecular weight of 373.92 g/mol. Its IUPAC name is bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]azanide;copper(1+).
| Compound Name | bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]azanide;copper(1+) |
|---|---|
| PubChem CID | 135987878 |
| Molecular Formula | C18H20CuN3O2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]azanide;copper(1+) |
| SMILES | Oc1ccccc1/C=N/CC[N-]CC/N=C/c1ccccc1O.[Cu+] |
| InChI | InChI=1S/C18H20N3O2.Cu/c22-17-7-3-1-5-15(17)13-20-11-9-19-10-12-21-14-16-6-2-4-8-18(16)23;/h1-8,13-14,22-23H,9-12H2;/q-1;+1/b20-13+,21-14+; |
| InChIKey | JPBPWBHZZPLFLS-MVYGGZIESA-N |
| XLogP | 3.01 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|