C17H18ClCrN2O7- — CID 135501072
2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol;oxochromium;perchlorate (PubChem CID 135501072) has the molecular formula C17H18ClCrN2O7- and a molecular weight of 449.79 g/mol. Its IUPAC name is 2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol;oxochromium;perchlorate.
| Compound Name | 2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol;oxochromium;perchlorate |
|---|---|
| PubChem CID | 135501072 |
| Molecular Formula | C17H18ClCrN2O7- |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 2-[3-[(2-hydroxyphenyl)methylideneamino]propyliminomethyl]phenol;oxochromium;perchlorate |
| SMILES | O=[Cr].Oc1ccccc1/C=N\CCC/N=C/c1ccccc1O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H18N2O2.ClHO4.Cr.O/c20-16-8-3-1-6-14(16)12-18-10-5-11-19-13-15-7-2-4-9-17(15)21;2-1(3,4)5;;/h1-4,6-9,12-13,20-21H,5,10-11H2;(H,2,3,4,5);;/p-1/b18-12-,19-13+;;; |
| InChIKey | KIJJAXAQKGVRAS-MWPTWBDRSA-M |
| XLogP | -1.85 |
| TPSA | 174.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|