C17H14MgO3+2 — CID 19939019
magnesium 2-(3,4-dimethylphenyl)-3-hydroxychromen-4-one (PubChem CID 19939019) has the molecular formula C17H14MgO3+2 and a molecular weight of 290.60 g/mol. Its IUPAC name is magnesium 2-(3,4-dimethylphenyl)-3-hydroxychromen-4-one.
| Compound Name | magnesium 2-(3,4-dimethylphenyl)-3-hydroxychromen-4-one |
|---|---|
| PubChem CID | 19939019 |
| Molecular Formula | C17H14MgO3+2 |
| Molecular Weight | 290.60 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | magnesium 2-(3,4-dimethylphenyl)-3-hydroxychromen-4-one |
| SMILES | Cc1ccc(-c2oc3ccccc3c(=O)c2O)cc1C.[Mg+2] |
| InChI | InChI=1S/C17H14O3.Mg/c1-10-7-8-12(9-11(10)2)17-16(19)15(18)13-5-3-4-6-14(13)20-17;/h3-9,19H,1-2H3;/q;+2 |
| InChIKey | LHBRAJXPRZEYII-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |