C18H16O4 — CID 59679761
2-(3,4-dimethylphenyl)-3,5-dihydroxy-7-methylchromen-4-one (PubChem CID 59679761) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-3,5-dihydroxy-7-methylchromen-4-one.
| Compound Name | 2-(3,4-dimethylphenyl)-3,5-dihydroxy-7-methylchromen-4-one |
|---|---|
| PubChem CID | 59679761 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-3,5-dihydroxy-7-methylchromen-4-one |
| SMILES | Cc1cc(O)c2c(=O)c(O)c(-c3ccc(C)c(C)c3)oc2c1 |
| InChI | InChI=1S/C18H16O4/c1-9-6-13(19)15-14(7-9)22-18(17(21)16(15)20)12-5-4-10(2)11(3)8-12/h4-8,19,21H,1-3H3 |
| InChIKey | PRERXXPHXOCKRO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |