C15H9IO5 — CID 10453329
3,5,7-trihydroxy-2-(4-iodophenyl)chromen-4-one (PubChem CID 10453329) has the molecular formula C15H9IO5 and a molecular weight of 396.14 g/mol. Its IUPAC name is 3,5,7-trihydroxy-2-(4-iodophenyl)chromen-4-one.
| Compound Name | 3,5,7-trihydroxy-2-(4-iodophenyl)chromen-4-one |
|---|---|
| PubChem CID | 10453329 |
| Molecular Formula | C15H9IO5 |
| Molecular Weight | 396.14 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-iodophenyl)chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(I)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H9IO5/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,17-18,20H |
| InChIKey | JZGNQOUGTXYCBJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|