C15H10O8 — CID 5281672
3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 5281672) has the molecular formula C15H10O8 and a molecular weight of 318.24 g/mol. Its IUPAC name is 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 5281672 |
| Molecular Formula | C15H10O8 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | O=c1c(O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,16-20,22H |
| InChIKey | IKMDFBPHZNJCSN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|