C18H16O8 — CID 171457615
5,7-dihydroxy-3-propan-2-yloxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 171457615) has the molecular formula C18H16O8 and a molecular weight of 360.32 g/mol. Its IUPAC name is 5,7-dihydroxy-3-propan-2-yloxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-propan-2-yloxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 171457615 |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5,7-dihydroxy-3-propan-2-yloxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | CC(C)Oc1c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C18H16O8/c1-7(2)25-18-16(24)14-10(20)5-9(19)6-13(14)26-17(18)8-3-11(21)15(23)12(22)4-8/h3-7,19-23H,1-2H3 |
| InChIKey | PTHPGYIPWITZNV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|