C15H10ClNaO7 — CID 175300152
sodium;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;chloride (PubChem CID 175300152) has the molecular formula C15H10ClNaO7 and a molecular weight of 360.68 g/mol. Its IUPAC name is sodium;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;chloride.
| Compound Name | sodium;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;chloride |
|---|---|
| PubChem CID | 175300152 |
| Molecular Formula | C15H10ClNaO7 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | sodium;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;chloride |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12.[Cl-].[Na+] |
| InChI | InChI=1S/C15H10O7.ClH.Na/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;;/h1-5,16-19,21H;1H;/q;;+1/p-1 |
| InChIKey | RUWKDXYGNKZOCA-UHFFFAOYSA-M |
| XLogP | -4.00 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|