C29H26N4O8 — CID 139048298
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dipyridin-4-yldiazene;oxolane (PubChem CID 139048298) has the molecular formula C29H26N4O8 and a molecular weight of 558.55 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dipyridin-4-yldiazene;oxolane.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dipyridin-4-yldiazene;oxolane |
|---|---|
| PubChem CID | 139048298 |
| Molecular Formula | C29H26N4O8 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;dipyridin-4-yldiazene;oxolane |
| SMILES | C1CCOC1.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12.c1cc(/N=N/c2ccncc2)ccn1 |
| InChI | InChI=1S/C15H10O7.C10H8N4.C4H8O/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10;1-2-4-5-3-1/h1-5,16-19,21H;1-8H;1-4H2/b;14-13+; |
| InChIKey | YJPBDKWIUPHWMR-RXDJDOOOSA-N |
| XLogP | 5.68 |
| TPSA | 191.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|