C15H10O6Zn — CID 175939811
3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;zinc (PubChem CID 175939811) has the molecular formula C15H10O6Zn and a molecular weight of 351.63 g/mol. Its IUPAC name is 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;zinc.
| Compound Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;zinc |
|---|---|
| PubChem CID | 175939811 |
| Molecular Formula | C15H10O6Zn |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 3,5,7-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one;zinc |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12.[Zn] |
| InChI | InChI=1S/C15H10O6.Zn/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15;/h1-6,16-18,20H; |
| InChIKey | NWKVEICTSBZFOC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|