C15H10O5 — CID 162642124
3,5,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 162642124) has the molecular formula C15H10O5 and a molecular weight of 273.22 g/mol. Its IUPAC name is 3,5,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | 3,5,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 162642124 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3,5,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | O=[13c]1c2c(O)cc(O)cc2o[13c](-c2ccccc2)[13c]1O |
| InChI | InChI=1S/C15H10O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,16-17,19H/i13+1,14+1,15+1 |
| InChIKey | VCCRNZQBSJXYJD-UIDJNKKJSA-N |
| XLogP | 2.58 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |