C15H9N3O5 — CID 101084152
2-(4-azidophenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 101084152) has the molecular formula C15H9N3O5 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-(4-azidophenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-(4-azidophenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 101084152 |
| Molecular Formula | C15H9N3O5 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-(4-azidophenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | [N-]=[N+]=Nc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C15H9N3O5/c16-18-17-8-3-1-7(2-4-8)15-14(22)13(21)12-10(20)5-9(19)6-11(12)23-15/h1-6,19-20,22H |
| InChIKey | QOJXQVQBHCHWMN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|