C20H21N3O7 — CID 163497268
1-azido-3-methylbutane;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 163497268) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-azido-3-methylbutane;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 1-azido-3-methylbutane;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 163497268 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-azido-3-methylbutane;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | CC(C)CCN=[N+]=[N-].O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7.C5H11N3/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;1-5(2)3-4-7-8-6/h1-5,16-19,21H;5H,3-4H2,1-2H3 |
| InChIKey | CRUJJSGKPZBOPX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 180.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|