C39H46N6O7 — CID 139048285
2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;tris(2,3,5,6-tetramethylpyrazine) (PubChem CID 139048285) has the molecular formula C39H46N6O7 and a molecular weight of 710.83 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;tris(2,3,5,6-tetramethylpyrazine).
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;tris(2,3,5,6-tetramethylpyrazine) |
|---|---|
| PubChem CID | 139048285 |
| Molecular Formula | C39H46N6O7 |
| Molecular Weight | 710.83 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one;tris(2,3,5,6-tetramethylpyrazine) |
| SMILES | Cc1nc(C)c(C)nc1C.Cc1nc(C)c(C)nc1C.Cc1nc(C)c(C)nc1C.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7.3C8H12N2/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;3*1-5-6(2)10-8(4)7(3)9-5/h1-5,16-19,21H;3*1-4H3 |
| InChIKey | VAYWBPBCDJZMCT-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 208.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|