C16H9NO6 — CID 167352798
2-(1,3-benzoxazol-6-yl)-3,5,7-trihydroxychromen-4-one (PubChem CID 167352798) has the molecular formula C16H9NO6 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-6-yl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-(1,3-benzoxazol-6-yl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 167352798 |
| Molecular Formula | C16H9NO6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-(1,3-benzoxazol-6-yl)-3,5,7-trihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc3ncoc3c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C16H9NO6/c18-8-4-10(19)13-12(5-8)23-16(15(21)14(13)20)7-1-2-9-11(3-7)22-6-17-9/h1-6,18-19,21H |
| InChIKey | HKTCSZFVVHNNFY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |