C16H10O7 — CID 86205753
4-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzoic acid (PubChem CID 86205753) has the molecular formula C16H10O7 and a molecular weight of 314.25 g/mol. Its IUPAC name is 4-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzoic acid.
| Compound Name | 4-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 86205753 |
| Molecular Formula | C16H10O7 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C16H10O7/c17-9-5-10(18)12-11(6-9)23-15(14(20)13(12)19)7-1-3-8(4-2-7)16(21)22/h1-6,17-18,20H,(H,21,22) |
| InChIKey | FTXNKCMCCHQYOF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |