C15H10O9S — CID 101243369
3-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid (PubChem CID 101243369) has the molecular formula C15H10O9S and a molecular weight of 366.30 g/mol. Its IUPAC name is 3-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid.
| Compound Name | 3-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 101243369 |
| Molecular Formula | C15H10O9S |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 3-hydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid |
| SMILES | O=c1c(O)c(-c2cc(O)cc(S(=O)(=O)O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O9S/c16-7-1-6(2-9(3-7)25(21,22)23)15-14(20)13(19)12-10(18)4-8(17)5-11(12)24-15/h1-5,16-18,20H,(H,21,22,23) |
| InChIKey | HAOPPRVNVJLKHJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|