C15H10O10S — CID 12978681
2,4-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid (PubChem CID 12978681) has the molecular formula C15H10O10S and a molecular weight of 382.30 g/mol. Its IUPAC name is 2,4-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid.
| Compound Name | 2,4-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 12978681 |
| Molecular Formula | C15H10O10S |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2,4-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)benzenesulfonic acid |
| SMILES | O=c1c(O)c(-c2cc(S(=O)(=O)O)c(O)cc2O)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O10S/c16-5-1-9(19)12-10(2-5)25-15(14(21)13(12)20)6-3-11(26(22,23)24)8(18)4-7(6)17/h1-4,16-19,21H,(H,22,23,24) |
| InChIKey | PKAQEIQKUZQKHK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|