C21H22O13 — CID 70292403
cyclohexane-1,2,3,4,5,6-hexol;2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 70292403) has the molecular formula C21H22O13 and a molecular weight of 482.39 g/mol. Its IUPAC name is cyclohexane-1,2,3,4,5,6-hexol;2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | cyclohexane-1,2,3,4,5,6-hexol;2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 70292403 |
| Molecular Formula | C21H22O13 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol;2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)cc2O)oc2cc(O)cc(O)c12.OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C15H10O7.C6H12O6/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15;7-1-2(8)4(10)6(12)5(11)3(1)9/h1-5,16-19,21H;1-12H |
| InChIKey | AWTPINCBGWQHNW-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 252.74 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |