C15H9NO8 — CID 24840571
[2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] nitrite (PubChem CID 24840571) has the molecular formula C15H9NO8 and a molecular weight of 331.24 g/mol. Its IUPAC name is [2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] nitrite.
| Compound Name | [2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] nitrite |
|---|---|
| PubChem CID | 24840571 |
| Molecular Formula | C15H9NO8 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | [2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl] nitrite |
| SMILES | O=NOc1c(-c2ccc(O)cc2O)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C15H9NO8/c17-6-1-2-8(9(19)3-6)14-15(24-16-22)13(21)12-10(20)4-7(18)5-11(12)23-14/h1-5,17-20H |
| InChIKey | ZDFIQEJISGPLRS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 149.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|