C21H14O5 — CID 143758219
3,6,7-trihydroxy-2,5-diphenylchromen-4-one (PubChem CID 143758219) has the molecular formula C21H14O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3,6,7-trihydroxy-2,5-diphenylchromen-4-one.
| Compound Name | 3,6,7-trihydroxy-2,5-diphenylchromen-4-one |
|---|---|
| PubChem CID | 143758219 |
| Molecular Formula | C21H14O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3,6,7-trihydroxy-2,5-diphenylchromen-4-one |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2cc(O)c(O)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H14O5/c22-14-11-15-17(16(18(14)23)12-7-3-1-4-8-12)19(24)20(25)21(26-15)13-9-5-2-6-10-13/h1-11,22-23,25H |
| InChIKey | RDUKYUTUIJUUMP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|