C20H19NO6 — CID 174605613
pyrrolidine;3,5,7-trihydroxy-4-oxo-2-phenylchromene-6-carbaldehyde (PubChem CID 174605613) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is pyrrolidine;3,5,7-trihydroxy-4-oxo-2-phenylchromene-6-carbaldehyde.
| Compound Name | pyrrolidine;3,5,7-trihydroxy-4-oxo-2-phenylchromene-6-carbaldehyde |
|---|---|
| PubChem CID | 174605613 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | pyrrolidine;3,5,7-trihydroxy-4-oxo-2-phenylchromene-6-carbaldehyde |
| SMILES | C1CCNC1.O=Cc1c(O)cc2oc(-c3ccccc3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C16H10O6.C4H9N/c17-7-9-10(18)6-11-12(13(9)19)14(20)15(21)16(22-11)8-4-2-1-3-5-8;1-2-4-5-3-1/h1-7,18-19,21H;5H,1-4H2 |
| InChIKey | WLYTXXQEHBKLFV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|