C15H8BrIO4 — CID 70417264
7-bromo-3,5-dihydroxy-6-iodo-2-phenylchromen-4-one (PubChem CID 70417264) has the molecular formula C15H8BrIO4 and a molecular weight of 459.03 g/mol. Its IUPAC name is 7-bromo-3,5-dihydroxy-6-iodo-2-phenylchromen-4-one.
| Compound Name | 7-bromo-3,5-dihydroxy-6-iodo-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 70417264 |
| Molecular Formula | C15H8BrIO4 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 457.87 |
| IUPAC Name | 7-bromo-3,5-dihydroxy-6-iodo-2-phenylchromen-4-one |
| SMILES | O=c1c(O)c(-c2ccccc2)oc2cc(Br)c(I)c(O)c12 |
| InChI | InChI=1S/C15H8BrIO4/c16-8-6-9-10(12(18)11(8)17)13(19)14(20)15(21-9)7-4-2-1-3-5-7/h1-6,18,20H |
| InChIKey | NAPVXUMKSHDWTR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|