C19H21NO5 — CID 144894370
8-(2-aminoethyl)-3,5,7-trihydroxy-2-phenylchromen-4-one;ethane (PubChem CID 144894370) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 8-(2-aminoethyl)-3,5,7-trihydroxy-2-phenylchromen-4-one;ethane.
| Compound Name | 8-(2-aminoethyl)-3,5,7-trihydroxy-2-phenylchromen-4-one;ethane |
|---|---|
| PubChem CID | 144894370 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 8-(2-aminoethyl)-3,5,7-trihydroxy-2-phenylchromen-4-one;ethane |
| SMILES | CC.NCCc1c(O)cc(O)c2c(=O)c(O)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C17H15NO5.C2H6/c18-7-6-10-11(19)8-12(20)13-14(21)15(22)16(23-17(10)13)9-4-2-1-3-5-9;1-2/h1-5,8,19-20,22H,6-7,18H2;1-2H3 |
| InChIKey | XLZFLLUAWAJHRM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |