C22H25IO7 — CID 159326427
iodo(tritio)methane;3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 159326427) has the molecular formula C22H25IO7 and a molecular weight of 530.35 g/mol. Its IUPAC name is iodo(tritio)methane;3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | iodo(tritio)methane;3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 159326427 |
| Molecular Formula | C22H25IO7 |
| Molecular Weight | 530.35 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | iodo(tritio)methane;3,5,7-trihydroxy-8-(3-hydroxy-3-methylbutyl)-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2oc3c(CCC(C)(C)O)c(O)cc(O)c3c(=O)c2O)cc1.[3H]CI |
| InChI | InChI=1S/C21H22O7.CH3I/c1-21(2,26)9-8-13-14(22)10-15(23)16-17(24)18(25)19(28-20(13)16)11-4-6-12(27-3)7-5-11;1-2/h4-7,10,22-23,25-26H,8-9H2,1-3H3;1H3/i;1T |
| InChIKey | LEKQGFDNCWQGMP-WMTCLNHOSA-N |
| XLogP | 4.34 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|