C26H28O6 — CID 53492213
3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3-methylbut-2-enoxy)-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 53492213) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is 3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3-methylbut-2-enoxy)-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3-methylbut-2-enoxy)-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 53492213 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3,5-dihydroxy-2-(4-methoxyphenyl)-7-(3-methylbut-2-enoxy)-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OCC=C(C)C)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C26H28O6/c1-15(2)6-11-19-21(31-13-12-16(3)4)14-20(27)22-23(28)24(29)25(32-26(19)22)17-7-9-18(30-5)10-8-17/h6-10,12,14,27,29H,11,13H2,1-5H3 |
| InChIKey | HGNYXFCKDGYEOQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|