C30H35NO11 — CID 171351577
[5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-7-yl] N,N-dimethylcarbamate (PubChem CID 171351577) has the molecular formula C30H35NO11 and a molecular weight of 585.61 g/mol. Its IUPAC name is [5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 171351577 |
| Molecular Formula | C30H35NO11 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | [5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxo-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-7-yl] N,N-dimethylcarbamate |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OC(=O)N(C)C)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H35NO11/c1-14(2)7-12-18-20(40-30(37)31(4)5)13-19(32)21-23(34)28(42-29-25(36)24(35)22(33)15(3)39-29)26(41-27(18)21)16-8-10-17(38-6)11-9-16/h7-11,13,15,22,24-25,29,32-33,35-36H,12H2,1-6H3/t15-,22-,24+,25+,29-/m0/s1 |
| InChIKey | IPACJYXRAUYQKB-XLXCCCDPSA-N |
| XLogP | 2.95 |
| TPSA | 168.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|