C35H45NO11 — CID 171354377
5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-(4-morpholin-4-ylbutoxy)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one (PubChem CID 171354377) has the molecular formula C35H45NO11 and a molecular weight of 655.74 g/mol. Its IUPAC name is 5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-(4-morpholin-4-ylbutoxy)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one.
| Compound Name | 5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-(4-morpholin-4-ylbutoxy)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 171354377 |
| Molecular Formula | C35H45NO11 |
| Molecular Weight | 655.74 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | 5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-7-(4-morpholin-4-ylbutoxy)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OCCCCN4CCOCC4)cc(O)c3c(=O)c2O[C@H]2O[C@H](C)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C35H45NO11/c1-20(2)7-12-24-26(44-16-6-5-13-36-14-17-43-18-15-36)19-25(37)27-29(39)34(47-35-31(41)30(40)28(38)21(3)45-35)32(46-33(24)27)22-8-10-23(42-4)11-9-22/h7-11,19,21,28,30-31,35,37-38,40-41H,5-6,12-18H2,1-4H3/t21-,28-,30+,31+,35-/m1/s1 |
| InChIKey | WISLZDRHVVDECU-NGHQBMGZSA-N |
| XLogP | 3.38 |
| TPSA | 160.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|