C18H15NO7 — CID 126595540
2-[3,5,7-trihydroxy-2-(4-methoxyphenyl)-4-oxochromen-8-yl]acetamide (PubChem CID 126595540) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[3,5,7-trihydroxy-2-(4-methoxyphenyl)-4-oxochromen-8-yl]acetamide.
| Compound Name | 2-[3,5,7-trihydroxy-2-(4-methoxyphenyl)-4-oxochromen-8-yl]acetamide |
|---|---|
| PubChem CID | 126595540 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[3,5,7-trihydroxy-2-(4-methoxyphenyl)-4-oxochromen-8-yl]acetamide |
| SMILES | COc1ccc(-c2oc3c(CC(N)=O)c(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C18H15NO7/c1-25-9-4-2-8(3-5-9)17-16(24)15(23)14-12(21)7-11(20)10(6-13(19)22)18(14)26-17/h2-5,7,20-21,24H,6H2,1H3,(H2,19,22) |
| InChIKey | HJIGLVLUXZOXRL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |