C19H18O8 — CID 10643114
3,6-dihydroxy-5,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 10643114) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is 3,6-dihydroxy-5,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 3,6-dihydroxy-5,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 10643114 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3,6-dihydroxy-5,7,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)c(O)c(OC)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C19H18O8/c1-23-10-7-5-9(6-8-10)15-13(21)12(20)11-16(24-2)14(22)18(25-3)19(26-4)17(11)27-15/h5-8,21-22H,1-4H3 |
| InChIKey | RRFXJUQQKKAIBM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |