C17H14O7 — CID 70253991
3,5,8-trihydroxy-6,7-dimethoxy-2-phenylchromen-4-one (PubChem CID 70253991) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 3,5,8-trihydroxy-6,7-dimethoxy-2-phenylchromen-4-one.
| Compound Name | 3,5,8-trihydroxy-6,7-dimethoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 70253991 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3,5,8-trihydroxy-6,7-dimethoxy-2-phenylchromen-4-one |
| SMILES | COc1c(OC)c(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1O |
| InChI | InChI=1S/C17H14O7/c1-22-16-11(19)9-10(18)12(20)14(8-6-4-3-5-7-8)24-15(9)13(21)17(16)23-2/h3-7,19-21H,1-2H3 |
| InChIKey | WPYIFCJESKORSR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|