C19H18O9 — CID 172651857
2-(2,3-dihydroxyphenyl)-8-hydroxy-3,5,6,7-tetramethoxychromen-4-one (PubChem CID 172651857) has the molecular formula C19H18O9 and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-8-hydroxy-3,5,6,7-tetramethoxychromen-4-one.
| Compound Name | 2-(2,3-dihydroxyphenyl)-8-hydroxy-3,5,6,7-tetramethoxychromen-4-one |
|---|---|
| PubChem CID | 172651857 |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-8-hydroxy-3,5,6,7-tetramethoxychromen-4-one |
| SMILES | COc1c(OC)c(OC)c2c(=O)c(OC)c(-c3cccc(O)c3O)oc2c1O |
| InChI | InChI=1S/C19H18O9/c1-24-16-10-12(22)17(25-2)14(8-6-5-7-9(20)11(8)21)28-15(10)13(23)18(26-3)19(16)27-4/h5-7,20-21,23H,1-4H3 |
| InChIKey | RRTOSJSZANLAJP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|