C18H16O6 — CID 172643077
2-(2,3-dimethoxyphenyl)-3-hydroxy-5-methoxychromen-4-one (PubChem CID 172643077) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-3-hydroxy-5-methoxychromen-4-one.
| Compound Name | 2-(2,3-dimethoxyphenyl)-3-hydroxy-5-methoxychromen-4-one |
|---|---|
| PubChem CID | 172643077 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-3-hydroxy-5-methoxychromen-4-one |
| SMILES | COc1cccc(-c2oc3cccc(OC)c3c(=O)c2O)c1OC |
| InChI | InChI=1S/C18H16O6/c1-21-11-7-5-8-12-14(11)15(19)16(20)18(24-12)10-6-4-9-13(22-2)17(10)23-3/h4-9,20H,1-3H3 |
| InChIKey | FTEWBEHOLYGMBM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |