C12H12O5 — CID 19930053
3,4,5-trimethoxychromen-2-one (PubChem CID 19930053) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is 3,4,5-trimethoxychromen-2-one.
| Compound Name | 3,4,5-trimethoxychromen-2-one |
|---|---|
| PubChem CID | 19930053 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3,4,5-trimethoxychromen-2-one |
| SMILES | COc1c(OC)c2c(OC)cccc2oc1=O |
| InChI | InChI=1S/C12H12O5/c1-14-7-5-4-6-8-9(7)10(15-2)11(16-3)12(13)17-8/h4-6H,1-3H3 |
| InChIKey | SPSQPEZRSZITNS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|