C22H14O8 — CID 87234772
1,2-bis(5-methoxy-2-oxochromen-3-yl)ethane-1,2-dione (PubChem CID 87234772) has the molecular formula C22H14O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is 1,2-bis(5-methoxy-2-oxochromen-3-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(5-methoxy-2-oxochromen-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 87234772 |
| Molecular Formula | C22H14O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1,2-bis(5-methoxy-2-oxochromen-3-yl)ethane-1,2-dione |
| SMILES | COc1cccc2oc(=O)c(C(=O)C(=O)c3cc4c(OC)cccc4oc3=O)cc12 |
| InChI | InChI=1S/C22H14O8/c1-27-15-5-3-7-17-11(15)9-13(21(25)29-17)19(23)20(24)14-10-12-16(28-2)6-4-8-18(12)30-22(14)26/h3-10H,1-2H3 |
| InChIKey | DSOJWCJWRRQLSI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|