C21H17NO6 — CID 87235008
5-methoxy-N-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-2-oxochromene-3-carboxamide (PubChem CID 87235008) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 5-methoxy-N-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-2-oxochromene-3-carboxamide.
| Compound Name | 5-methoxy-N-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 87235008 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-methoxy-N-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=O)c2cc3c(OC)cccc3oc2=O)cc1 |
| InChI | InChI=1S/C21H17NO6/c1-26-14-9-6-13(7-10-14)8-11-19(23)22-20(24)16-12-15-17(27-2)4-3-5-18(15)28-21(16)25/h3-12H,1-2H3,(H,22,23,24)/b11-8+ |
| InChIKey | UPFQLPOGYXZIOO-DHZHZOJOSA-N |
| XLogP | 2.78 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|