C26H20N2O4S — CID 2198684
(E)-3-(4-methoxyphenyl)-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 2198684) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 2198684 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2cccc(-c3cc4ccccc4oc3=O)c2)cc1 |
| InChI | InChI=1S/C26H20N2O4S/c1-31-21-12-9-17(10-13-21)11-14-24(29)28-26(33)27-20-7-4-6-18(15-20)22-16-19-5-2-3-8-23(19)32-25(22)30/h2-16H,1H3,(H2,27,28,29,33)/b14-11+ |
| InChIKey | AXMSEXKVUYROHM-SDNWHVSQSA-N |
| XLogP | 4.99 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|