C23H14Cl2N2O3S — CID 17109805
3,4-dichloro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17109805) has the molecular formula C23H14Cl2N2O3S and a molecular weight of 469.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17109805 |
| Molecular Formula | C23H14Cl2N2O3S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 3,4-dichloro-N-[[3-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2cc3ccccc3oc2=O)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H14Cl2N2O3S/c24-18-9-8-15(12-19(18)25)21(28)27-23(31)26-16-6-3-5-13(10-16)17-11-14-4-1-2-7-20(14)30-22(17)29/h1-12H,(H2,26,27,28,31) |
| InChIKey | KBBQZAFEJUHAMT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|