C23H15NO5 — CID 28675540
4-[[3-(2-oxochromen-3-yl)benzoyl]amino]benzoic acid (PubChem CID 28675540) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 4-[[3-(2-oxochromen-3-yl)benzoyl]amino]benzoic acid.
| Compound Name | 4-[[3-(2-oxochromen-3-yl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28675540 |
| Molecular Formula | C23H15NO5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[[3-(2-oxochromen-3-yl)benzoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cccc(-c3cc4ccccc4oc3=O)c2)cc1 |
| InChI | InChI=1S/C23H15NO5/c25-21(24-18-10-8-14(9-11-18)22(26)27)17-6-3-5-15(12-17)19-13-16-4-1-2-7-20(16)29-23(19)28/h1-13H,(H,24,25)(H,26,27) |
| InChIKey | UWACVJIHJANJTQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|