C35H31N3O4 — CID 17050042
N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3-(2-oxochromen-3-yl)benzamide (PubChem CID 17050042) has the molecular formula C35H31N3O4 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 17050042 |
| Molecular Formula | C35H31N3O4 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]-3-(2-oxochromen-3-yl)benzamide |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(NC(=O)c4cccc(-c5cc6ccccc6oc5=O)c4)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H31N3O4/c1-2-24-10-12-25(13-11-24)34(40)38-20-18-37(19-21-38)30-16-14-29(15-17-30)36-33(39)28-8-5-7-26(22-28)31-23-27-6-3-4-9-32(27)42-35(31)41/h3-17,22-23H,2,18-21H2,1H3,(H,36,39) |
| InChIKey | UTIKOGXABHUYHM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|