C24H25NO4 — CID 171385946
3-[3-[4-(1-hydroxypropyl)piperidine-1-carbonyl]phenyl]chromen-2-one (PubChem CID 171385946) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-[3-[4-(1-hydroxypropyl)piperidine-1-carbonyl]phenyl]chromen-2-one.
| Compound Name | 3-[3-[4-(1-hydroxypropyl)piperidine-1-carbonyl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 171385946 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-[3-[4-(1-hydroxypropyl)piperidine-1-carbonyl]phenyl]chromen-2-one |
| SMILES | CCC(O)C1CCN(C(=O)c2cccc(-c3cc4ccccc4oc3=O)c2)CC1 |
| InChI | InChI=1S/C24H25NO4/c1-2-21(26)16-10-12-25(13-11-16)23(27)19-8-5-7-17(14-19)20-15-18-6-3-4-9-22(18)29-24(20)28/h3-9,14-16,21,26H,2,10-13H2,1H3 |
| InChIKey | IQKQOSMXULEWGI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|