C22H21NO4 — CID 171908503
3-[3-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]chromen-2-one (PubChem CID 171908503) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[3-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]chromen-2-one.
| Compound Name | 3-[3-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 171908503 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-[3-[(3S)-3-ethylmorpholine-4-carbonyl]phenyl]chromen-2-one |
| SMILES | CC[C@H]1COCCN1C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H21NO4/c1-2-18-14-26-11-10-23(18)21(24)17-8-5-7-15(12-17)19-13-16-6-3-4-9-20(16)27-22(19)25/h3-9,12-13,18H,2,10-11,14H2,1H3/t18-/m0/s1 |
| InChIKey | HMWLQFIRHOHGFZ-SFHVURJKSA-N |
| XLogP | 3.71 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|